C28H30Cl2N4O6S — CID 24900968
4-[[2-(2,4-dichlorophenoxy)phenyl]sulfamoyl]-N-[2-(3-morpholin-4-ylpropylamino)-2-oxoethyl]benzamide (PubChem CID 24900968) has the molecular formula C28H30Cl2N4O6S and a molecular weight of 621.54 g/mol. Its IUPAC name is 4-[[2-(2,4-dichlorophenoxy)phenyl]sulfamoyl]-N-[2-(3-morpholin-4-ylpropylamino)-2-oxoethyl]benzamide.
| Compound Name | 4-[[2-(2,4-dichlorophenoxy)phenyl]sulfamoyl]-N-[2-(3-morpholin-4-ylpropylamino)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 24900968 |
| Molecular Formula | C28H30Cl2N4O6S |
| Molecular Weight | 621.54 g/mol |
| Exact Mass | 620.13 |
| IUPAC Name | 4-[[2-(2,4-dichlorophenoxy)phenyl]sulfamoyl]-N-[2-(3-morpholin-4-ylpropylamino)-2-oxoethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccc(S(=O)(=O)Nc2ccccc2Oc2ccc(Cl)cc2Cl)cc1)NCCCN1CCOCC1 |
| InChI | InChI=1S/C28H30Cl2N4O6S/c29-21-8-11-25(23(30)18-21)40-26-5-2-1-4-24(26)33-41(37,38)22-9-6-20(7-10-22)28(36)32-19-27(35)31-12-3-13-34-14-16-39-17-15-34/h1-2,4-11,18,33H,3,12-17,19H2,(H,31,35)(H,32,36) |
| InChIKey | JUBMHNSYAJYJFG-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.54 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|