C34H43N5O5S — CID 24900839
N-[2-oxo-2-[3-(4-piperidin-1-ylpiperidin-1-yl)propylamino]ethyl]-4-[(2-phenoxyphenyl)sulfamoyl]benzamide (PubChem CID 24900839) has the molecular formula C34H43N5O5S and a molecular weight of 633.82 g/mol. Its IUPAC name is N-[2-oxo-2-[3-(4-piperidin-1-ylpiperidin-1-yl)propylamino]ethyl]-4-[(2-phenoxyphenyl)sulfamoyl]benzamide.
| Compound Name | N-[2-oxo-2-[3-(4-piperidin-1-ylpiperidin-1-yl)propylamino]ethyl]-4-[(2-phenoxyphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 24900839 |
| Molecular Formula | C34H43N5O5S |
| Molecular Weight | 633.82 g/mol |
| Exact Mass | 633.30 |
| IUPAC Name | N-[2-oxo-2-[3-(4-piperidin-1-ylpiperidin-1-yl)propylamino]ethyl]-4-[(2-phenoxyphenyl)sulfamoyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccc(S(=O)(=O)Nc2ccccc2Oc2ccccc2)cc1)NCCCN1CCC(N2CCCCC2)CC1 |
| InChI | InChI=1S/C34H43N5O5S/c40-33(35-20-9-21-38-24-18-28(19-25-38)39-22-7-2-8-23-39)26-36-34(41)27-14-16-30(17-15-27)45(42,43)37-31-12-5-6-13-32(31)44-29-10-3-1-4-11-29/h1,3-6,10-17,28,37H,2,7-9,18-26H2,(H,35,40)(H,36,41) |
| InChIKey | KHUGRFXCTDYGBV-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.82 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|