C37H41N5O5S — CID 24900838
N-[2-oxo-2-[4-(4-piperidin-1-ylpiperidin-1-yl)anilino]ethyl]-4-[(2-phenoxyphenyl)sulfamoyl]benzamide (PubChem CID 24900838) has the molecular formula C37H41N5O5S and a molecular weight of 667.83 g/mol. Its IUPAC name is N-[2-oxo-2-[4-(4-piperidin-1-ylpiperidin-1-yl)anilino]ethyl]-4-[(2-phenoxyphenyl)sulfamoyl]benzamide.
| Compound Name | N-[2-oxo-2-[4-(4-piperidin-1-ylpiperidin-1-yl)anilino]ethyl]-4-[(2-phenoxyphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 24900838 |
| Molecular Formula | C37H41N5O5S |
| Molecular Weight | 667.83 g/mol |
| Exact Mass | 667.28 |
| IUPAC Name | N-[2-oxo-2-[4-(4-piperidin-1-ylpiperidin-1-yl)anilino]ethyl]-4-[(2-phenoxyphenyl)sulfamoyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccc(S(=O)(=O)Nc2ccccc2Oc2ccccc2)cc1)Nc1ccc(N2CCC(N3CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C37H41N5O5S/c43-36(39-29-15-17-30(18-16-29)42-25-21-31(22-26-42)41-23-7-2-8-24-41)27-38-37(44)28-13-19-33(20-14-28)48(45,46)40-34-11-5-6-12-35(34)47-32-9-3-1-4-10-32/h1,3-6,9-20,31,40H,2,7-8,21-27H2,(H,38,44)(H,39,43) |
| InChIKey | VAEPGNWDJJEQKI-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.83 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|