C22H20N2O7S — CID 68771863
(2R)-3-hydroxy-2-[[4-[(2-phenoxyphenyl)sulfamoyl]benzoyl]amino]propanoic acid (PubChem CID 68771863) has the molecular formula C22H20N2O7S and a molecular weight of 456.48 g/mol. Its IUPAC name is (2R)-3-hydroxy-2-[[4-[(2-phenoxyphenyl)sulfamoyl]benzoyl]amino]propanoic acid.
| Compound Name | (2R)-3-hydroxy-2-[[4-[(2-phenoxyphenyl)sulfamoyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 68771863 |
| Molecular Formula | C22H20N2O7S |
| Molecular Weight | 456.48 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | (2R)-3-hydroxy-2-[[4-[(2-phenoxyphenyl)sulfamoyl]benzoyl]amino]propanoic acid |
| SMILES | O=C(N[C@H](CO)C(=O)O)c1ccc(S(=O)(=O)Nc2ccccc2Oc2ccccc2)cc1 |
| InChI | InChI=1S/C22H20N2O7S/c25-14-19(22(27)28)23-21(26)15-10-12-17(13-11-15)32(29,30)24-18-8-4-5-9-20(18)31-16-6-2-1-3-7-16/h1-13,19,24-25H,14H2,(H,23,26)(H,27,28)/t19-/m1/s1 |
| InChIKey | DPIRARSIHMHGHJ-LJQANCHMSA-N |
| XLogP | 2.45 |
| TPSA | 142.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.48 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |