C21H18N2O6S — CID 31475850
2-[[4-[(2-phenoxyphenyl)sulfamoyl]benzoyl]amino]acetic acid (PubChem CID 31475850) has the molecular formula C21H18N2O6S and a molecular weight of 426.45 g/mol. Its IUPAC name is 2-[[4-[(2-phenoxyphenyl)sulfamoyl]benzoyl]amino]acetic acid.
| Compound Name | 2-[[4-[(2-phenoxyphenyl)sulfamoyl]benzoyl]amino]acetic acid |
|---|---|
| PubChem CID | 31475850 |
| Molecular Formula | C21H18N2O6S |
| Molecular Weight | 426.45 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | 2-[[4-[(2-phenoxyphenyl)sulfamoyl]benzoyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)c1ccc(S(=O)(=O)Nc2ccccc2Oc2ccccc2)cc1 |
| InChI | InChI=1S/C21H18N2O6S/c24-20(25)14-22-21(26)15-10-12-17(13-11-15)30(27,28)23-18-8-4-5-9-19(18)29-16-6-2-1-3-7-16/h1-13,23H,14H2,(H,22,26)(H,24,25) |
| InChIKey | XGMAMBSWHAZBLX-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.45 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |