C21H17FN2O6S — CID 68577142
2-[[4-[[2-(4-fluorophenoxy)phenyl]sulfamoyl]benzoyl]amino]acetic acid (PubChem CID 68577142) has the molecular formula C21H17FN2O6S and a molecular weight of 444.44 g/mol. Its IUPAC name is 2-[[4-[[2-(4-fluorophenoxy)phenyl]sulfamoyl]benzoyl]amino]acetic acid.
| Compound Name | 2-[[4-[[2-(4-fluorophenoxy)phenyl]sulfamoyl]benzoyl]amino]acetic acid |
|---|---|
| PubChem CID | 68577142 |
| Molecular Formula | C21H17FN2O6S |
| Molecular Weight | 444.44 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | 2-[[4-[[2-(4-fluorophenoxy)phenyl]sulfamoyl]benzoyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)c1ccc(S(=O)(=O)Nc2ccccc2Oc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C21H17FN2O6S/c22-15-7-9-16(10-8-15)30-19-4-2-1-3-18(19)24-31(28,29)17-11-5-14(6-12-17)21(27)23-13-20(25)26/h1-12,24H,13H2,(H,23,27)(H,25,26) |
| InChIKey | MXDVIYQSCHTUED-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |