C31H39N5O5S — CID 87472420
N-[(2S)-6-amino-1-oxo-1-(piperidin-4-ylmethylamino)hexan-2-yl]-4-[(2-phenoxyphenyl)sulfamoyl]benzamide (PubChem CID 87472420) has the molecular formula C31H39N5O5S and a molecular weight of 593.75 g/mol. Its IUPAC name is N-[(2S)-6-amino-1-oxo-1-(piperidin-4-ylmethylamino)hexan-2-yl]-4-[(2-phenoxyphenyl)sulfamoyl]benzamide.
| Compound Name | N-[(2S)-6-amino-1-oxo-1-(piperidin-4-ylmethylamino)hexan-2-yl]-4-[(2-phenoxyphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 87472420 |
| Molecular Formula | C31H39N5O5S |
| Molecular Weight | 593.75 g/mol |
| Exact Mass | 593.27 |
| IUPAC Name | N-[(2S)-6-amino-1-oxo-1-(piperidin-4-ylmethylamino)hexan-2-yl]-4-[(2-phenoxyphenyl)sulfamoyl]benzamide |
| SMILES | NCCCC[C@H](NC(=O)c1ccc(S(=O)(=O)Nc2ccccc2Oc2ccccc2)cc1)C(=O)NCC1CCNCC1 |
| InChI | InChI=1S/C31H39N5O5S/c32-19-7-6-11-28(31(38)34-22-23-17-20-33-21-18-23)35-30(37)24-13-15-26(16-14-24)42(39,40)36-27-10-4-5-12-29(27)41-25-8-2-1-3-9-25/h1-5,8-10,12-16,23,28,33,36H,6-7,11,17-22,32H2,(H,34,38)(H,35,37)/t28-/m0/s1 |
| InChIKey | KZLSAUGWMZQWAA-NDEPHWFRSA-N |
| XLogP | 3.62 |
| TPSA | 151.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.75 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|