C29H31Cl2N3O5S — CID 142791325
4-[[2-(2,4-dichlorophenoxy)phenyl]sulfamoyl]-N-(3-oxo-5-piperidin-4-ylpentyl)benzamide (PubChem CID 142791325) has the molecular formula C29H31Cl2N3O5S and a molecular weight of 604.56 g/mol. Its IUPAC name is 4-[[2-(2,4-dichlorophenoxy)phenyl]sulfamoyl]-N-(3-oxo-5-piperidin-4-ylpentyl)benzamide.
| Compound Name | 4-[[2-(2,4-dichlorophenoxy)phenyl]sulfamoyl]-N-(3-oxo-5-piperidin-4-ylpentyl)benzamide |
|---|---|
| PubChem CID | 142791325 |
| Molecular Formula | C29H31Cl2N3O5S |
| Molecular Weight | 604.56 g/mol |
| Exact Mass | 603.14 |
| IUPAC Name | 4-[[2-(2,4-dichlorophenoxy)phenyl]sulfamoyl]-N-(3-oxo-5-piperidin-4-ylpentyl)benzamide |
| SMILES | O=C(CCNC(=O)c1ccc(S(=O)(=O)Nc2ccccc2Oc2ccc(Cl)cc2Cl)cc1)CCC1CCNCC1 |
| InChI | InChI=1S/C29H31Cl2N3O5S/c30-22-8-12-27(25(31)19-22)39-28-4-2-1-3-26(28)34-40(37,38)24-10-6-21(7-11-24)29(36)33-18-15-23(35)9-5-20-13-16-32-17-14-20/h1-4,6-8,10-12,19-20,32,34H,5,9,13-18H2,(H,33,36) |
| InChIKey | VJZKUSKJPWKHMK-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.56 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |