C30H35Cl3N4O5S — CID 87471136
4-[(2,4-dichlorophenoxy)-phenylsulfamoyl]-N-[2-oxo-2-(4-piperidin-4-ylbutylamino)ethyl]benzamide;hydrochloride (PubChem CID 87471136) has the molecular formula C30H35Cl3N4O5S and a molecular weight of 670.06 g/mol. Its IUPAC name is 4-[(2,4-dichlorophenoxy)-phenylsulfamoyl]-N-[2-oxo-2-(4-piperidin-4-ylbutylamino)ethyl]benzamide;hydrochloride.
| Compound Name | 4-[(2,4-dichlorophenoxy)-phenylsulfamoyl]-N-[2-oxo-2-(4-piperidin-4-ylbutylamino)ethyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 87471136 |
| Molecular Formula | C30H35Cl3N4O5S |
| Molecular Weight | 670.06 g/mol |
| Exact Mass | 668.14 |
| IUPAC Name | 4-[(2,4-dichlorophenoxy)-phenylsulfamoyl]-N-[2-oxo-2-(4-piperidin-4-ylbutylamino)ethyl]benzamide;hydrochloride |
| SMILES | Cl.O=C(CNC(=O)c1ccc(S(=O)(=O)N(Oc2ccc(Cl)cc2Cl)c2ccccc2)cc1)NCCCCC1CCNCC1 |
| InChI | InChI=1S/C30H34Cl2N4O5S.ClH/c31-24-11-14-28(27(32)20-24)41-36(25-7-2-1-3-8-25)42(39,40)26-12-9-23(10-13-26)30(38)35-21-29(37)34-17-5-4-6-22-15-18-33-19-16-22;/h1-3,7-14,20,22,33H,4-6,15-19,21H2,(H,34,37)(H,35,38);1H |
| InChIKey | OCIFYXMZNRJONS-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.06 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|