C23H20ClFN2O6S — CID 87471816
ethyl 2-[[4-[(2-chloro-4-fluorophenoxy)-phenylsulfamoyl]benzoyl]amino]acetate (PubChem CID 87471816) has the molecular formula C23H20ClFN2O6S and a molecular weight of 506.94 g/mol. Its IUPAC name is ethyl 2-[[4-[(2-chloro-4-fluorophenoxy)-phenylsulfamoyl]benzoyl]amino]acetate.
| Compound Name | ethyl 2-[[4-[(2-chloro-4-fluorophenoxy)-phenylsulfamoyl]benzoyl]amino]acetate |
|---|---|
| PubChem CID | 87471816 |
| Molecular Formula | C23H20ClFN2O6S |
| Molecular Weight | 506.94 g/mol |
| Exact Mass | 506.07 |
| IUPAC Name | ethyl 2-[[4-[(2-chloro-4-fluorophenoxy)-phenylsulfamoyl]benzoyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=O)c1ccc(S(=O)(=O)N(Oc2ccc(F)cc2Cl)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H20ClFN2O6S/c1-2-32-22(28)15-26-23(29)16-8-11-19(12-9-16)34(30,31)27(18-6-4-3-5-7-18)33-21-13-10-17(25)14-20(21)24/h3-14H,2,15H2,1H3,(H,26,29) |
| InChIKey | ASPQBXJSFHNUQH-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.94 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|