C30H34Cl2N4O5S — CID 91369414
N-[2-[butyl(piperidin-1-yl)amino]-2-oxoethyl]-4-[(2,4-dichlorophenoxy)-phenylsulfamoyl]benzamide (PubChem CID 91369414) has the molecular formula C30H34Cl2N4O5S and a molecular weight of 633.60 g/mol. Its IUPAC name is N-[2-[butyl(piperidin-1-yl)amino]-2-oxoethyl]-4-[(2,4-dichlorophenoxy)-phenylsulfamoyl]benzamide.
| Compound Name | N-[2-[butyl(piperidin-1-yl)amino]-2-oxoethyl]-4-[(2,4-dichlorophenoxy)-phenylsulfamoyl]benzamide |
|---|---|
| PubChem CID | 91369414 |
| Molecular Formula | C30H34Cl2N4O5S |
| Molecular Weight | 633.60 g/mol |
| Exact Mass | 632.16 |
| IUPAC Name | N-[2-[butyl(piperidin-1-yl)amino]-2-oxoethyl]-4-[(2,4-dichlorophenoxy)-phenylsulfamoyl]benzamide |
| SMILES | CCCCN(C(=O)CNC(=O)c1ccc(S(=O)(=O)N(Oc2ccc(Cl)cc2Cl)c2ccccc2)cc1)N1CCCCC1 |
| InChI | InChI=1S/C30H34Cl2N4O5S/c1-2-3-20-35(34-18-8-5-9-19-34)29(37)22-33-30(38)23-12-15-26(16-13-23)42(39,40)36(25-10-6-4-7-11-25)41-28-17-14-24(31)21-27(28)32/h4,6-7,10-17,21H,2-3,5,8-9,18-20,22H2,1H3,(H,33,38) |
| InChIKey | DNMYSFMWBDKORU-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.60 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|