C30H35Cl2N5O5S — CID 87503231
4-[(2,4-dichlorophenoxy)-phenylsulfamoyl]-N-[2-[4-[3-(dimethylamino)propyl]piperazin-1-yl]-2-oxoethyl]benzamide (PubChem CID 87503231) has the molecular formula C30H35Cl2N5O5S and a molecular weight of 648.61 g/mol. Its IUPAC name is 4-[(2,4-dichlorophenoxy)-phenylsulfamoyl]-N-[2-[4-[3-(dimethylamino)propyl]piperazin-1-yl]-2-oxoethyl]benzamide.
| Compound Name | 4-[(2,4-dichlorophenoxy)-phenylsulfamoyl]-N-[2-[4-[3-(dimethylamino)propyl]piperazin-1-yl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 87503231 |
| Molecular Formula | C30H35Cl2N5O5S |
| Molecular Weight | 648.61 g/mol |
| Exact Mass | 647.17 |
| IUPAC Name | 4-[(2,4-dichlorophenoxy)-phenylsulfamoyl]-N-[2-[4-[3-(dimethylamino)propyl]piperazin-1-yl]-2-oxoethyl]benzamide |
| SMILES | CN(C)CCCN1CCN(C(=O)CNC(=O)c2ccc(S(=O)(=O)N(Oc3ccc(Cl)cc3Cl)c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C30H35Cl2N5O5S/c1-34(2)15-6-16-35-17-19-36(20-18-35)29(38)22-33-30(39)23-9-12-26(13-10-23)43(40,41)37(25-7-4-3-5-8-25)42-28-14-11-24(31)21-27(28)32/h3-5,7-14,21H,6,15-20,22H2,1-2H3,(H,33,39) |
| InChIKey | KSEBZJBZNYUXTR-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 102.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.61 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|