C30H34Cl2N4O5S — CID 87472007
4-[(2,4-dichlorophenoxy)-phenylsulfamoyl]-N-[2-oxo-2-(4-piperidin-1-ylbutylamino)ethyl]benzamide (PubChem CID 87472007) has the molecular formula C30H34Cl2N4O5S and a molecular weight of 633.60 g/mol. Its IUPAC name is 4-[(2,4-dichlorophenoxy)-phenylsulfamoyl]-N-[2-oxo-2-(4-piperidin-1-ylbutylamino)ethyl]benzamide.
| Compound Name | 4-[(2,4-dichlorophenoxy)-phenylsulfamoyl]-N-[2-oxo-2-(4-piperidin-1-ylbutylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 87472007 |
| Molecular Formula | C30H34Cl2N4O5S |
| Molecular Weight | 633.60 g/mol |
| Exact Mass | 632.16 |
| IUPAC Name | 4-[(2,4-dichlorophenoxy)-phenylsulfamoyl]-N-[2-oxo-2-(4-piperidin-1-ylbutylamino)ethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccc(S(=O)(=O)N(Oc2ccc(Cl)cc2Cl)c2ccccc2)cc1)NCCCCN1CCCCC1 |
| InChI | InChI=1S/C30H34Cl2N4O5S/c31-24-13-16-28(27(32)21-24)41-36(25-9-3-1-4-10-25)42(39,40)26-14-11-23(12-15-26)30(38)34-22-29(37)33-17-5-8-20-35-18-6-2-7-19-35/h1,3-4,9-16,21H,2,5-8,17-20,22H2,(H,33,37)(H,34,38) |
| InChIKey | PLHOCXVIMKMGON-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.60 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|