C29H34N4O5S — CID 71008233
N-[2-oxo-2-(3-piperidin-1-ylpropylamino)ethyl]-4-[(4-phenoxyphenyl)sulfamoyl]benzamide (PubChem CID 71008233) has the molecular formula C29H34N4O5S and a molecular weight of 550.68 g/mol. Its IUPAC name is N-[2-oxo-2-(3-piperidin-1-ylpropylamino)ethyl]-4-[(4-phenoxyphenyl)sulfamoyl]benzamide.
| Compound Name | N-[2-oxo-2-(3-piperidin-1-ylpropylamino)ethyl]-4-[(4-phenoxyphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 71008233 |
| Molecular Formula | C29H34N4O5S |
| Molecular Weight | 550.68 g/mol |
| Exact Mass | 550.22 |
| IUPAC Name | N-[2-oxo-2-(3-piperidin-1-ylpropylamino)ethyl]-4-[(4-phenoxyphenyl)sulfamoyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccc(S(=O)(=O)Nc2ccc(Oc3ccccc3)cc2)cc1)NCCCN1CCCCC1 |
| InChI | InChI=1S/C29H34N4O5S/c34-28(30-18-7-21-33-19-5-2-6-20-33)22-31-29(35)23-10-16-27(17-11-23)39(36,37)32-24-12-14-26(15-13-24)38-25-8-3-1-4-9-25/h1,3-4,8-17,32H,2,5-7,18-22H2,(H,30,34)(H,31,35) |
| InChIKey | IXBNTPXKVWNXRV-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.68 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|