C36H42Cl2N4O7S — CID 87486888
tert-butyl 4-[[[1-[4-[(2,4-dichlorophenoxy)-phenylsulfamoyl]benzoyl]piperidine-4-carbonyl]amino]methyl]piperidine-1-carboxylate (PubChem CID 87486888) has the molecular formula C36H42Cl2N4O7S and a molecular weight of 745.73 g/mol. Its IUPAC name is tert-butyl 4-[[[1-[4-[(2,4-dichlorophenoxy)-phenylsulfamoyl]benzoyl]piperidine-4-carbonyl]amino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[[1-[4-[(2,4-dichlorophenoxy)-phenylsulfamoyl]benzoyl]piperidine-4-carbonyl]amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 87486888 |
| Molecular Formula | C36H42Cl2N4O7S |
| Molecular Weight | 745.73 g/mol |
| Exact Mass | 744.22 |
| IUPAC Name | tert-butyl 4-[[[1-[4-[(2,4-dichlorophenoxy)-phenylsulfamoyl]benzoyl]piperidine-4-carbonyl]amino]methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CNC(=O)C2CCN(C(=O)c3ccc(S(=O)(=O)N(Oc4ccc(Cl)cc4Cl)c4ccccc4)cc3)CC2)CC1 |
| InChI | InChI=1S/C36H42Cl2N4O7S/c1-36(2,3)48-35(45)41-19-15-25(16-20-41)24-39-33(43)26-17-21-40(22-18-26)34(44)27-9-12-30(13-10-27)50(46,47)42(29-7-5-4-6-8-29)49-32-14-11-28(37)23-31(32)38/h4-14,23,25-26H,15-22,24H2,1-3H3,(H,39,43) |
| InChIKey | RDMBXFOVKPBZDG-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 125.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.73 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|