C33H40N4O7S — CID 87472046
tert-butyl 4-[[[2-[methyl-[4-[phenoxy(phenyl)sulfamoyl]benzoyl]amino]acetyl]amino]methyl]piperidine-1-carboxylate (PubChem CID 87472046) has the molecular formula C33H40N4O7S and a molecular weight of 636.77 g/mol. Its IUPAC name is tert-butyl 4-[[[2-[methyl-[4-[phenoxy(phenyl)sulfamoyl]benzoyl]amino]acetyl]amino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[[2-[methyl-[4-[phenoxy(phenyl)sulfamoyl]benzoyl]amino]acetyl]amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 87472046 |
| Molecular Formula | C33H40N4O7S |
| Molecular Weight | 636.77 g/mol |
| Exact Mass | 636.26 |
| IUPAC Name | tert-butyl 4-[[[2-[methyl-[4-[phenoxy(phenyl)sulfamoyl]benzoyl]amino]acetyl]amino]methyl]piperidine-1-carboxylate |
| SMILES | CN(CC(=O)NCC1CCN(C(=O)OC(C)(C)C)CC1)C(=O)c1ccc(S(=O)(=O)N(Oc2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C33H40N4O7S/c1-33(2,3)43-32(40)36-21-19-25(20-22-36)23-34-30(38)24-35(4)31(39)26-15-17-29(18-16-26)45(41,42)37(27-11-7-5-8-12-27)44-28-13-9-6-10-14-28/h5-18,25H,19-24H2,1-4H3,(H,34,38) |
| InChIKey | NIQMSJAZKSKXJL-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 125.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.77 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|