C25H33N3O5S — CID 118720901
tert-butyl 4-[[methyl-[4-(phenylsulfamoyl)benzoyl]amino]methyl]piperidine-1-carboxylate (PubChem CID 118720901) has the molecular formula C25H33N3O5S and a molecular weight of 487.62 g/mol. Its IUPAC name is tert-butyl 4-[[methyl-[4-(phenylsulfamoyl)benzoyl]amino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[methyl-[4-(phenylsulfamoyl)benzoyl]amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 118720901 |
| Molecular Formula | C25H33N3O5S |
| Molecular Weight | 487.62 g/mol |
| Exact Mass | 487.21 |
| IUPAC Name | tert-butyl 4-[[methyl-[4-(phenylsulfamoyl)benzoyl]amino]methyl]piperidine-1-carboxylate |
| SMILES | CN(CC1CCN(C(=O)OC(C)(C)C)CC1)C(=O)c1ccc(S(=O)(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C25H33N3O5S/c1-25(2,3)33-24(30)28-16-14-19(15-17-28)18-27(4)23(29)20-10-12-22(13-11-20)34(31,32)26-21-8-6-5-7-9-21/h5-13,19,26H,14-18H2,1-4H3 |
| InChIKey | SRGYPZUCDIFDTE-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.62 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |