C34H40N4O7S — CID 87471303
tert-butyl 4-[[[1-[[4-[phenoxy(phenyl)sulfamoyl]benzoyl]amino]cyclopropanecarbonyl]amino]methyl]piperidine-1-carboxylate (PubChem CID 87471303) has the molecular formula C34H40N4O7S and a molecular weight of 648.78 g/mol. Its IUPAC name is tert-butyl 4-[[[1-[[4-[phenoxy(phenyl)sulfamoyl]benzoyl]amino]cyclopropanecarbonyl]amino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[[1-[[4-[phenoxy(phenyl)sulfamoyl]benzoyl]amino]cyclopropanecarbonyl]amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 87471303 |
| Molecular Formula | C34H40N4O7S |
| Molecular Weight | 648.78 g/mol |
| Exact Mass | 648.26 |
| IUPAC Name | tert-butyl 4-[[[1-[[4-[phenoxy(phenyl)sulfamoyl]benzoyl]amino]cyclopropanecarbonyl]amino]methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CNC(=O)C2(NC(=O)c3ccc(S(=O)(=O)N(Oc4ccccc4)c4ccccc4)cc3)CC2)CC1 |
| InChI | InChI=1S/C34H40N4O7S/c1-33(2,3)44-32(41)37-22-18-25(19-23-37)24-35-31(40)34(20-21-34)36-30(39)26-14-16-29(17-15-26)46(42,43)38(27-10-6-4-7-11-27)45-28-12-8-5-9-13-28/h4-17,25H,18-24H2,1-3H3,(H,35,40)(H,36,39) |
| InChIKey | DCFFKMNNOPLVKG-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 134.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.78 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|