C35H43N5O8S — CID 87471954
tert-butyl 4-[[[5-amino-5-oxo-2-[[4-[phenoxy(phenyl)sulfamoyl]benzoyl]amino]pentanoyl]amino]methyl]piperidine-1-carboxylate (PubChem CID 87471954) has the molecular formula C35H43N5O8S and a molecular weight of 693.82 g/mol. Its IUPAC name is tert-butyl 4-[[[5-amino-5-oxo-2-[[4-[phenoxy(phenyl)sulfamoyl]benzoyl]amino]pentanoyl]amino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[[5-amino-5-oxo-2-[[4-[phenoxy(phenyl)sulfamoyl]benzoyl]amino]pentanoyl]amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 87471954 |
| Molecular Formula | C35H43N5O8S |
| Molecular Weight | 693.82 g/mol |
| Exact Mass | 693.28 |
| IUPAC Name | tert-butyl 4-[[[5-amino-5-oxo-2-[[4-[phenoxy(phenyl)sulfamoyl]benzoyl]amino]pentanoyl]amino]methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CNC(=O)C(CCC(N)=O)NC(=O)c2ccc(S(=O)(=O)N(Oc3ccccc3)c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C35H43N5O8S/c1-35(2,3)47-34(44)39-22-20-25(21-23-39)24-37-33(43)30(18-19-31(36)41)38-32(42)26-14-16-29(17-15-26)49(45,46)40(27-10-6-4-7-11-27)48-28-12-8-5-9-13-28/h4-17,25,30H,18-24H2,1-3H3,(H2,36,41)(H,37,43)(H,38,42) |
| InChIKey | IHESLAAIBFBHQF-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 177.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.82 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|