C35H46N4O4S — CID 87486436
4-[[3-(diethylamino)phenoxy]-phenylsulfamoyl]-N-[4-(2-pyrrolidin-1-ylethyl)cyclohexyl]benzamide (PubChem CID 87486436) has the molecular formula C35H46N4O4S and a molecular weight of 618.84 g/mol. Its IUPAC name is 4-[[3-(diethylamino)phenoxy]-phenylsulfamoyl]-N-[4-(2-pyrrolidin-1-ylethyl)cyclohexyl]benzamide.
| Compound Name | 4-[[3-(diethylamino)phenoxy]-phenylsulfamoyl]-N-[4-(2-pyrrolidin-1-ylethyl)cyclohexyl]benzamide |
|---|---|
| PubChem CID | 87486436 |
| Molecular Formula | C35H46N4O4S |
| Molecular Weight | 618.84 g/mol |
| Exact Mass | 618.32 |
| IUPAC Name | 4-[[3-(diethylamino)phenoxy]-phenylsulfamoyl]-N-[4-(2-pyrrolidin-1-ylethyl)cyclohexyl]benzamide |
| SMILES | CCN(CC)c1cccc(ON(c2ccccc2)S(=O)(=O)c2ccc(C(=O)NC3CCC(CCN4CCCC4)CC3)cc2)c1 |
| InChI | InChI=1S/C35H46N4O4S/c1-3-38(4-2)32-13-10-14-33(27-32)43-39(31-11-6-5-7-12-31)44(41,42)34-21-17-29(18-22-34)35(40)36-30-19-15-28(16-20-30)23-26-37-24-8-9-25-37/h5-7,10-14,17-18,21-22,27-28,30H,3-4,8-9,15-16,19-20,23-26H2,1-2H3,(H,36,40) |
| InChIKey | MWAYVDKEXNGOST-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.84 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|