C27H31N3O3S — CID 55735053
N-[1-[(3-methylphenyl)methyl]piperidin-4-yl]-4-[methyl(phenyl)sulfamoyl]benzamide (PubChem CID 55735053) has the molecular formula C27H31N3O3S and a molecular weight of 477.63 g/mol. Its IUPAC name is N-[1-[(3-methylphenyl)methyl]piperidin-4-yl]-4-[methyl(phenyl)sulfamoyl]benzamide.
| Compound Name | N-[1-[(3-methylphenyl)methyl]piperidin-4-yl]-4-[methyl(phenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 55735053 |
| Molecular Formula | C27H31N3O3S |
| Molecular Weight | 477.63 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | N-[1-[(3-methylphenyl)methyl]piperidin-4-yl]-4-[methyl(phenyl)sulfamoyl]benzamide |
| SMILES | Cc1cccc(CN2CCC(NC(=O)c3ccc(S(=O)(=O)N(C)c4ccccc4)cc3)CC2)c1 |
| InChI | InChI=1S/C27H31N3O3S/c1-21-7-6-8-22(19-21)20-30-17-15-24(16-18-30)28-27(31)23-11-13-26(14-12-23)34(32,33)29(2)25-9-4-3-5-10-25/h3-14,19,24H,15-18,20H2,1-2H3,(H,28,31) |
| InChIKey | POANYEJDJHQWSC-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.63 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |