C22H28N2O3S — CID 55745159
2-methyl-N-[1-[(3-methylphenyl)methyl]piperidin-4-yl]-5-methylsulfonylbenzamide (PubChem CID 55745159) has the molecular formula C22H28N2O3S and a molecular weight of 400.54 g/mol. Its IUPAC name is 2-methyl-N-[1-[(3-methylphenyl)methyl]piperidin-4-yl]-5-methylsulfonylbenzamide.
| Compound Name | 2-methyl-N-[1-[(3-methylphenyl)methyl]piperidin-4-yl]-5-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 55745159 |
| Molecular Formula | C22H28N2O3S |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 2-methyl-N-[1-[(3-methylphenyl)methyl]piperidin-4-yl]-5-methylsulfonylbenzamide |
| SMILES | Cc1cccc(CN2CCC(NC(=O)c3cc(S(C)(=O)=O)ccc3C)CC2)c1 |
| InChI | InChI=1S/C22H28N2O3S/c1-16-5-4-6-18(13-16)15-24-11-9-19(10-12-24)23-22(25)21-14-20(28(3,26)27)8-7-17(21)2/h4-8,13-14,19H,9-12,15H2,1-3H3,(H,23,25) |
| InChIKey | KSEXSPLHYFOZFD-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |