C28H31N3O2 — CID 55844142
3-benzamido-4-methyl-N-[1-[(3-methylphenyl)methyl]piperidin-4-yl]benzamide (PubChem CID 55844142) has the molecular formula C28H31N3O2 and a molecular weight of 441.58 g/mol. Its IUPAC name is 3-benzamido-4-methyl-N-[1-[(3-methylphenyl)methyl]piperidin-4-yl]benzamide.
| Compound Name | 3-benzamido-4-methyl-N-[1-[(3-methylphenyl)methyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 55844142 |
| Molecular Formula | C28H31N3O2 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | 3-benzamido-4-methyl-N-[1-[(3-methylphenyl)methyl]piperidin-4-yl]benzamide |
| SMILES | Cc1cccc(CN2CCC(NC(=O)c3ccc(C)c(NC(=O)c4ccccc4)c3)CC2)c1 |
| InChI | InChI=1S/C28H31N3O2/c1-20-7-6-8-22(17-20)19-31-15-13-25(14-16-31)29-28(33)24-12-11-21(2)26(18-24)30-27(32)23-9-4-3-5-10-23/h3-12,17-18,25H,13-16,19H2,1-2H3,(H,29,33)(H,30,32) |
| InChIKey | BWQNVTAJGSTIOC-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |