C25H36ClN3O5S — CID 6602988
N-(1-benzylpiperidin-4-yl)-4-[bis(2-methoxyethyl)sulfamoyl]benzamide;hydrochloride (PubChem CID 6602988) has the molecular formula C25H36ClN3O5S and a molecular weight of 526.10 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-4-[bis(2-methoxyethyl)sulfamoyl]benzamide;hydrochloride.
| Compound Name | N-(1-benzylpiperidin-4-yl)-4-[bis(2-methoxyethyl)sulfamoyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 6602988 |
| Molecular Formula | C25H36ClN3O5S |
| Molecular Weight | 526.10 g/mol |
| Exact Mass | 525.21 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-4-[bis(2-methoxyethyl)sulfamoyl]benzamide;hydrochloride |
| SMILES | COCCN(CCOC)S(=O)(=O)c1ccc(C(=O)NC2CCN(Cc3ccccc3)CC2)cc1.Cl |
| InChI | InChI=1S/C25H35N3O5S.ClH/c1-32-18-16-28(17-19-33-2)34(30,31)24-10-8-22(9-11-24)25(29)26-23-12-14-27(15-13-23)20-21-6-4-3-5-7-21;/h3-11,23H,12-20H2,1-2H3,(H,26,29);1H |
| InChIKey | WOLHMCJNRHOWLK-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.10 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |