C36H42N4O4S — CID 87486307
4-[[3-(diethylamino)phenoxy]-phenylsulfamoyl]-N-[[4-(piperidin-4-ylmethyl)phenyl]methyl]benzamide (PubChem CID 87486307) has the molecular formula C36H42N4O4S and a molecular weight of 626.82 g/mol. Its IUPAC name is 4-[[3-(diethylamino)phenoxy]-phenylsulfamoyl]-N-[[4-(piperidin-4-ylmethyl)phenyl]methyl]benzamide.
| Compound Name | 4-[[3-(diethylamino)phenoxy]-phenylsulfamoyl]-N-[[4-(piperidin-4-ylmethyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 87486307 |
| Molecular Formula | C36H42N4O4S |
| Molecular Weight | 626.82 g/mol |
| Exact Mass | 626.29 |
| IUPAC Name | 4-[[3-(diethylamino)phenoxy]-phenylsulfamoyl]-N-[[4-(piperidin-4-ylmethyl)phenyl]methyl]benzamide |
| SMILES | CCN(CC)c1cccc(ON(c2ccccc2)S(=O)(=O)c2ccc(C(=O)NCc3ccc(CC4CCNCC4)cc3)cc2)c1 |
| InChI | InChI=1S/C36H42N4O4S/c1-3-39(4-2)33-11-8-12-34(26-33)44-40(32-9-6-5-7-10-32)45(42,43)35-19-17-31(18-20-35)36(41)38-27-30-15-13-28(14-16-30)25-29-21-23-37-24-22-29/h5-20,26,29,37H,3-4,21-25,27H2,1-2H3,(H,38,41) |
| InChIKey | NXUXVUPYYWCNTK-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.82 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|