C24H27ClN4O5S — CID 87471937
N-[2-[ethyl(methylamino)amino]-2-oxoethyl]-4-[phenoxy(phenyl)sulfamoyl]benzamide;hydrochloride (PubChem CID 87471937) has the molecular formula C24H27ClN4O5S and a molecular weight of 519.02 g/mol. Its IUPAC name is N-[2-[ethyl(methylamino)amino]-2-oxoethyl]-4-[phenoxy(phenyl)sulfamoyl]benzamide;hydrochloride.
| Compound Name | N-[2-[ethyl(methylamino)amino]-2-oxoethyl]-4-[phenoxy(phenyl)sulfamoyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 87471937 |
| Molecular Formula | C24H27ClN4O5S |
| Molecular Weight | 519.02 g/mol |
| Exact Mass | 518.14 |
| IUPAC Name | N-[2-[ethyl(methylamino)amino]-2-oxoethyl]-4-[phenoxy(phenyl)sulfamoyl]benzamide;hydrochloride |
| SMILES | CCN(NC)C(=O)CNC(=O)c1ccc(S(=O)(=O)N(Oc2ccccc2)c2ccccc2)cc1.Cl |
| InChI | InChI=1S/C24H26N4O5S.ClH/c1-3-27(25-2)23(29)18-26-24(30)19-14-16-22(17-15-19)34(31,32)28(20-10-6-4-7-11-20)33-21-12-8-5-9-13-21;/h4-17,25H,3,18H2,1-2H3,(H,26,30);1H |
| InChIKey | DBMJCXVIUXRWCE-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.02 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|