C29H24N4O5S — CID 87471771
N-[2-(1H-indol-5-ylamino)-2-oxoethyl]-4-[phenoxy(phenyl)sulfamoyl]benzamide (PubChem CID 87471771) has the molecular formula C29H24N4O5S and a molecular weight of 540.60 g/mol. Its IUPAC name is N-[2-(1H-indol-5-ylamino)-2-oxoethyl]-4-[phenoxy(phenyl)sulfamoyl]benzamide.
| Compound Name | N-[2-(1H-indol-5-ylamino)-2-oxoethyl]-4-[phenoxy(phenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 87471771 |
| Molecular Formula | C29H24N4O5S |
| Molecular Weight | 540.60 g/mol |
| Exact Mass | 540.15 |
| IUPAC Name | N-[2-(1H-indol-5-ylamino)-2-oxoethyl]-4-[phenoxy(phenyl)sulfamoyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccc(S(=O)(=O)N(Oc2ccccc2)c2ccccc2)cc1)Nc1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C29H24N4O5S/c34-28(32-23-13-16-27-22(19-23)17-18-30-27)20-31-29(35)21-11-14-26(15-12-21)39(36,37)33(24-7-3-1-4-8-24)38-25-9-5-2-6-10-25/h1-19,30H,20H2,(H,31,35)(H,32,34) |
| InChIKey | HLWBEHOQKYTNBF-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 120.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.60 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|