C27H32ClN5O6S — CID 87471127
N-ethyl-N-[2-[[4-[phenoxy(phenyl)sulfamoyl]benzoyl]amino]acetyl]piperazin-1-amine oxide;hydrochloride (PubChem CID 87471127) has the molecular formula C27H32ClN5O6S and a molecular weight of 590.10 g/mol. Its IUPAC name is N-ethyl-N-[2-[[4-[phenoxy(phenyl)sulfamoyl]benzoyl]amino]acetyl]piperazin-1-amine oxide;hydrochloride.
| Compound Name | N-ethyl-N-[2-[[4-[phenoxy(phenyl)sulfamoyl]benzoyl]amino]acetyl]piperazin-1-amine oxide;hydrochloride |
|---|---|
| PubChem CID | 87471127 |
| Molecular Formula | C27H32ClN5O6S |
| Molecular Weight | 590.10 g/mol |
| Exact Mass | 589.18 |
| IUPAC Name | N-ethyl-N-[2-[[4-[phenoxy(phenyl)sulfamoyl]benzoyl]amino]acetyl]piperazin-1-amine oxide;hydrochloride |
| SMILES | CC[N+]([O-])(C(=O)CNC(=O)c1ccc(S(=O)(=O)N(Oc2ccccc2)c2ccccc2)cc1)N1CCNCC1.Cl |
| InChI | InChI=1S/C27H31N5O6S.ClH/c1-2-32(35,30-19-17-28-18-20-30)26(33)21-29-27(34)22-13-15-25(16-14-22)39(36,37)31(23-9-5-3-6-10-23)38-24-11-7-4-8-12-24;/h3-16,28H,2,17-21H2,1H3,(H,29,34);1H |
| InChIKey | WCSIIDYYUMJKNT-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.10 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|