C28H32BrN3O4S — CID 87485640
4-[(4-bromophenoxy)-phenylsulfamoyl]-N-(4-piperidin-4-ylbutyl)benzamide (PubChem CID 87485640) has the molecular formula C28H32BrN3O4S and a molecular weight of 586.55 g/mol. Its IUPAC name is 4-[(4-bromophenoxy)-phenylsulfamoyl]-N-(4-piperidin-4-ylbutyl)benzamide.
| Compound Name | 4-[(4-bromophenoxy)-phenylsulfamoyl]-N-(4-piperidin-4-ylbutyl)benzamide |
|---|---|
| PubChem CID | 87485640 |
| Molecular Formula | C28H32BrN3O4S |
| Molecular Weight | 586.55 g/mol |
| Exact Mass | 585.13 |
| IUPAC Name | 4-[(4-bromophenoxy)-phenylsulfamoyl]-N-(4-piperidin-4-ylbutyl)benzamide |
| SMILES | O=C(NCCCCC1CCNCC1)c1ccc(S(=O)(=O)N(Oc2ccc(Br)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H32BrN3O4S/c29-24-11-13-26(14-12-24)36-32(25-7-2-1-3-8-25)37(34,35)27-15-9-23(10-16-27)28(33)31-19-5-4-6-22-17-20-30-21-18-22/h1-3,7-16,22,30H,4-6,17-21H2,(H,31,33) |
| InChIKey | OOQWVYGYJDKMQL-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.55 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|