C28H22N4O5S2 — CID 87472130
N-[2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl]-4-[phenoxy(phenyl)sulfamoyl]benzamide (PubChem CID 87472130) has the molecular formula C28H22N4O5S2 and a molecular weight of 558.64 g/mol. Its IUPAC name is N-[2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl]-4-[phenoxy(phenyl)sulfamoyl]benzamide.
| Compound Name | N-[2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl]-4-[phenoxy(phenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 87472130 |
| Molecular Formula | C28H22N4O5S2 |
| Molecular Weight | 558.64 g/mol |
| Exact Mass | 558.10 |
| IUPAC Name | N-[2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl]-4-[phenoxy(phenyl)sulfamoyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccc(S(=O)(=O)N(Oc2ccccc2)c2ccccc2)cc1)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C28H22N4O5S2/c33-26(31-28-30-24-13-7-8-14-25(24)38-28)19-29-27(34)20-15-17-23(18-16-20)39(35,36)32(21-9-3-1-4-10-21)37-22-11-5-2-6-12-22/h1-18H,19H2,(H,29,34)(H,30,31,33) |
| InChIKey | SOPZFVHZJSWTBF-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.64 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|