C23H21N3O4S2 — CID 2117790
N-(6-ethoxy-1,3-benzothiazol-2-yl)-4-[methyl(phenyl)sulfamoyl]benzamide (PubChem CID 2117790) has the molecular formula C23H21N3O4S2 and a molecular weight of 467.57 g/mol. Its IUPAC name is N-(6-ethoxy-1,3-benzothiazol-2-yl)-4-[methyl(phenyl)sulfamoyl]benzamide.
| Compound Name | N-(6-ethoxy-1,3-benzothiazol-2-yl)-4-[methyl(phenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 2117790 |
| Molecular Formula | C23H21N3O4S2 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.10 |
| IUPAC Name | N-(6-ethoxy-1,3-benzothiazol-2-yl)-4-[methyl(phenyl)sulfamoyl]benzamide |
| SMILES | CCOc1ccc2nc(NC(=O)c3ccc(S(=O)(=O)N(C)c4ccccc4)cc3)sc2c1 |
| InChI | InChI=1S/C23H21N3O4S2/c1-3-30-18-11-14-20-21(15-18)31-23(24-20)25-22(27)16-9-12-19(13-10-16)32(28,29)26(2)17-7-5-4-6-8-17/h4-15H,3H2,1-2H3,(H,24,25,27) |
| InChIKey | OUURJHNXEDTLDN-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |