C21H25N3O4S2 — CID 4673627
4-[butyl(methyl)sulfamoyl]-N-(6-ethoxy-1,3-benzothiazol-2-yl)benzamide (PubChem CID 4673627) has the molecular formula C21H25N3O4S2 and a molecular weight of 447.58 g/mol. Its IUPAC name is 4-[butyl(methyl)sulfamoyl]-N-(6-ethoxy-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | 4-[butyl(methyl)sulfamoyl]-N-(6-ethoxy-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 4673627 |
| Molecular Formula | C21H25N3O4S2 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | 4-[butyl(methyl)sulfamoyl]-N-(6-ethoxy-1,3-benzothiazol-2-yl)benzamide |
| SMILES | CCCCN(C)S(=O)(=O)c1ccc(C(=O)Nc2nc3ccc(OCC)cc3s2)cc1 |
| InChI | InChI=1S/C21H25N3O4S2/c1-4-6-13-24(3)30(26,27)17-10-7-15(8-11-17)20(25)23-21-22-18-12-9-16(28-5-2)14-19(18)29-21/h7-12,14H,4-6,13H2,1-3H3,(H,22,23,25) |
| InChIKey | RXUVYAMKNMLAER-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |