C18H18ClN3O4S2 — CID 26251712
4-chloro-3-(dimethylsulfamoyl)-N-(6-ethoxy-1,3-benzothiazol-2-yl)benzamide (PubChem CID 26251712) has the molecular formula C18H18ClN3O4S2 and a molecular weight of 439.95 g/mol. Its IUPAC name is 4-chloro-3-(dimethylsulfamoyl)-N-(6-ethoxy-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | 4-chloro-3-(dimethylsulfamoyl)-N-(6-ethoxy-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 26251712 |
| Molecular Formula | C18H18ClN3O4S2 |
| Molecular Weight | 439.95 g/mol |
| Exact Mass | 439.04 |
| IUPAC Name | 4-chloro-3-(dimethylsulfamoyl)-N-(6-ethoxy-1,3-benzothiazol-2-yl)benzamide |
| SMILES | CCOc1ccc2nc(NC(=O)c3ccc(Cl)c(S(=O)(=O)N(C)C)c3)sc2c1 |
| InChI | InChI=1S/C18H18ClN3O4S2/c1-4-26-12-6-8-14-15(10-12)27-18(20-14)21-17(23)11-5-7-13(19)16(9-11)28(24,25)22(2)3/h5-10H,4H2,1-3H3,(H,20,21,23) |
| InChIKey | LKAPFHYCURHPBN-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.95 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |