C21H25N3O5S2 — CID 26251702
3-(diethylsulfamoyl)-N-(6-ethoxy-1,3-benzothiazol-2-yl)-4-methoxybenzamide (PubChem CID 26251702) has the molecular formula C21H25N3O5S2 and a molecular weight of 463.58 g/mol. Its IUPAC name is 3-(diethylsulfamoyl)-N-(6-ethoxy-1,3-benzothiazol-2-yl)-4-methoxybenzamide.
| Compound Name | 3-(diethylsulfamoyl)-N-(6-ethoxy-1,3-benzothiazol-2-yl)-4-methoxybenzamide |
|---|---|
| PubChem CID | 26251702 |
| Molecular Formula | C21H25N3O5S2 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | 3-(diethylsulfamoyl)-N-(6-ethoxy-1,3-benzothiazol-2-yl)-4-methoxybenzamide |
| SMILES | CCOc1ccc2nc(NC(=O)c3ccc(OC)c(S(=O)(=O)N(CC)CC)c3)sc2c1 |
| InChI | InChI=1S/C21H25N3O5S2/c1-5-24(6-2)31(26,27)19-12-14(8-11-17(19)28-4)20(25)23-21-22-16-10-9-15(29-7-3)13-18(16)30-21/h8-13H,5-7H2,1-4H3,(H,22,23,25) |
| InChIKey | AFVDSFWSVIRVPX-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |