C30H33ClN2O3 — CID 58791136
tert-butyl 4-[[[4-chloro-3-(4-phenylphenyl)benzoyl]amino]methyl]piperidine-1-carboxylate (PubChem CID 58791136) has the molecular formula C30H33ClN2O3 and a molecular weight of 505.06 g/mol. Its IUPAC name is tert-butyl 4-[[[4-chloro-3-(4-phenylphenyl)benzoyl]amino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[[4-chloro-3-(4-phenylphenyl)benzoyl]amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 58791136 |
| Molecular Formula | C30H33ClN2O3 |
| Molecular Weight | 505.06 g/mol |
| Exact Mass | 504.22 |
| IUPAC Name | tert-butyl 4-[[[4-chloro-3-(4-phenylphenyl)benzoyl]amino]methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CNC(=O)c2ccc(Cl)c(-c3ccc(-c4ccccc4)cc3)c2)CC1 |
| InChI | InChI=1S/C30H33ClN2O3/c1-30(2,3)36-29(35)33-17-15-21(16-18-33)20-32-28(34)25-13-14-27(31)26(19-25)24-11-9-23(10-12-24)22-7-5-4-6-8-22/h4-14,19,21H,15-18,20H2,1-3H3,(H,32,34) |
| InChIKey | HVQOPYRVFXUQDQ-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.06 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |