C13H18N2O5S — CID 60812284
ethyl 2-[[4-(ethylsulfamoyl)benzoyl]amino]acetate (PubChem CID 60812284) has the molecular formula C13H18N2O5S and a molecular weight of 314.36 g/mol. Its IUPAC name is ethyl 2-[[4-(ethylsulfamoyl)benzoyl]amino]acetate.
| Compound Name | ethyl 2-[[4-(ethylsulfamoyl)benzoyl]amino]acetate |
|---|---|
| PubChem CID | 60812284 |
| Molecular Formula | C13H18N2O5S |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | ethyl 2-[[4-(ethylsulfamoyl)benzoyl]amino]acetate |
| SMILES | CCNS(=O)(=O)c1ccc(C(=O)NCC(=O)OCC)cc1 |
| InChI | InChI=1S/C13H18N2O5S/c1-3-15-21(18,19)11-7-5-10(6-8-11)13(17)14-9-12(16)20-4-2/h5-8,15H,3-4,9H2,1-2H3,(H,14,17) |
| InChIKey | YGIOZTHGQBPWHM-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |