C34H34Cl2N4O5S — CID 91335992
4-[1-[(2,4-dichlorophenoxy)-phenylsulfamoyl]-3-oxo-1-phenyl-3-(piperidin-4-ylmethylamino)propan-2-yl]benzamide (PubChem CID 91335992) has the molecular formula C34H34Cl2N4O5S and a molecular weight of 681.64 g/mol. Its IUPAC name is 4-[1-[(2,4-dichlorophenoxy)-phenylsulfamoyl]-3-oxo-1-phenyl-3-(piperidin-4-ylmethylamino)propan-2-yl]benzamide.
| Compound Name | 4-[1-[(2,4-dichlorophenoxy)-phenylsulfamoyl]-3-oxo-1-phenyl-3-(piperidin-4-ylmethylamino)propan-2-yl]benzamide |
|---|---|
| PubChem CID | 91335992 |
| Molecular Formula | C34H34Cl2N4O5S |
| Molecular Weight | 681.64 g/mol |
| Exact Mass | 680.16 |
| IUPAC Name | 4-[1-[(2,4-dichlorophenoxy)-phenylsulfamoyl]-3-oxo-1-phenyl-3-(piperidin-4-ylmethylamino)propan-2-yl]benzamide |
| SMILES | NC(=O)c1ccc(C(C(=O)NCC2CCNCC2)C(c2ccccc2)S(=O)(=O)N(Oc2ccc(Cl)cc2Cl)c2ccccc2)cc1 |
| InChI | InChI=1S/C34H34Cl2N4O5S/c35-27-15-16-30(29(36)21-27)45-40(28-9-5-2-6-10-28)46(43,44)32(25-7-3-1-4-8-25)31(24-11-13-26(14-12-24)33(37)41)34(42)39-22-23-17-19-38-20-18-23/h1-16,21,23,31-32,38H,17-20,22H2,(H2,37,41)(H,39,42) |
| InChIKey | GOBOFZBSHBICJE-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.64 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|