C30H28Cl2N6O5S — CID 24900842
N-[2-[[4-[(diaminomethylideneamino)methyl]phenyl]methylamino]-2-oxoethyl]-4-[[2-(2,4-dichlorophenoxy)phenyl]sulfamoyl]benzamide (PubChem CID 24900842) has the molecular formula C30H28Cl2N6O5S and a molecular weight of 655.56 g/mol. Its IUPAC name is N-[2-[[4-[(diaminomethylideneamino)methyl]phenyl]methylamino]-2-oxoethyl]-4-[[2-(2,4-dichlorophenoxy)phenyl]sulfamoyl]benzamide.
| Compound Name | N-[2-[[4-[(diaminomethylideneamino)methyl]phenyl]methylamino]-2-oxoethyl]-4-[[2-(2,4-dichlorophenoxy)phenyl]sulfamoyl]benzamide |
|---|---|
| PubChem CID | 24900842 |
| Molecular Formula | C30H28Cl2N6O5S |
| Molecular Weight | 655.56 g/mol |
| Exact Mass | 654.12 |
| IUPAC Name | N-[2-[[4-[(diaminomethylideneamino)methyl]phenyl]methylamino]-2-oxoethyl]-4-[[2-(2,4-dichlorophenoxy)phenyl]sulfamoyl]benzamide |
| SMILES | NC(N)=NCc1ccc(CNC(=O)CNC(=O)c2ccc(S(=O)(=O)Nc3ccccc3Oc3ccc(Cl)cc3Cl)cc2)cc1 |
| InChI | InChI=1S/C30H28Cl2N6O5S/c31-22-11-14-26(24(32)15-22)43-27-4-2-1-3-25(27)38-44(41,42)23-12-9-21(10-13-23)29(40)36-18-28(39)35-16-19-5-7-20(8-6-19)17-37-30(33)34/h1-15,38H,16-18H2,(H,35,39)(H,36,40)(H4,33,34,37) |
| InChIKey | LRSPCTBCPOFUKA-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 178.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.56 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|