C21H15AsCl2NO6S — CID 87619783
CID 87619783 (PubChem CID 87619783) has the molecular formula C21H15AsCl2NO6S and a molecular weight of 555.25 g/mol.
| Compound Name | CID 87619783 |
|---|---|
| PubChem CID | 87619783 |
| Molecular Formula | C21H15AsCl2NO6S |
| Molecular Weight | 555.25 g/mol |
| Exact Mass | 553.92 |
| IUPAC Name | — |
| SMILES | O=C(O)C[As]C(=O)c1ccc(S(=O)(=O)Nc2ccccc2Oc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C21H15AsCl2NO6S/c23-14-7-10-18(16(24)11-14)31-19-4-2-1-3-17(19)25-32(29,30)15-8-5-13(6-9-15)21(28)22-12-20(26)27/h1-11,25H,12H2,(H,26,27) |
| InChIKey | SSOGHBGJFBXRQB-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.25 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|