C13H19N3O5S — CID 175082787
(2S)-6-amino-2-[(4-sulfamoylbenzoyl)amino]hexanoic acid (PubChem CID 175082787) has the molecular formula C13H19N3O5S and a molecular weight of 329.38 g/mol. Its IUPAC name is (2S)-6-amino-2-[(4-sulfamoylbenzoyl)amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[(4-sulfamoylbenzoyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 175082787 |
| Molecular Formula | C13H19N3O5S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | (2S)-6-amino-2-[(4-sulfamoylbenzoyl)amino]hexanoic acid |
| SMILES | NCCCC[C@H](NC(=O)c1ccc(S(N)(=O)=O)cc1)C(=O)O |
| InChI | InChI=1S/C13H19N3O5S/c14-8-2-1-3-11(13(18)19)16-12(17)9-4-6-10(7-5-9)22(15,20)21/h4-7,11H,1-3,8,14H2,(H,16,17)(H,18,19)(H2,15,20,21)/t11-/m0/s1 |
| InChIKey | VVDQPDFAVATTDI-NSHDSACASA-N |
| XLogP | -0.35 |
| TPSA | 152.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|