C20H24N4O8S2 — CID 175082783
6-amino-2-[bis(4-sulfamoylbenzoyl)amino]hexanoic acid (PubChem CID 175082783) has the molecular formula C20H24N4O8S2 and a molecular weight of 512.57 g/mol. Its IUPAC name is 6-amino-2-[bis(4-sulfamoylbenzoyl)amino]hexanoic acid.
| Compound Name | 6-amino-2-[bis(4-sulfamoylbenzoyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 175082783 |
| Molecular Formula | C20H24N4O8S2 |
| Molecular Weight | 512.57 g/mol |
| Exact Mass | 512.10 |
| IUPAC Name | 6-amino-2-[bis(4-sulfamoylbenzoyl)amino]hexanoic acid |
| SMILES | NCCCCC(C(=O)O)N(C(=O)c1ccc(S(N)(=O)=O)cc1)C(=O)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C20H24N4O8S2/c21-12-2-1-3-17(20(27)28)24(18(25)13-4-8-15(9-5-13)33(22,29)30)19(26)14-6-10-16(11-7-14)34(23,31)32/h4-11,17H,1-3,12,21H2,(H,27,28)(H2,22,29,30)(H2,23,31,32) |
| InChIKey | MYTFUZBUJBWIMV-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 221.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.57 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|