C19H20N2O6 — CID 22838756
(2S)-5-amino-2-[bis(4-hydroxybenzoyl)amino]pentanoic acid (PubChem CID 22838756) has the molecular formula C19H20N2O6 and a molecular weight of 372.38 g/mol. Its IUPAC name is (2S)-5-amino-2-[bis(4-hydroxybenzoyl)amino]pentanoic acid.
| Compound Name | (2S)-5-amino-2-[bis(4-hydroxybenzoyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 22838756 |
| Molecular Formula | C19H20N2O6 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | (2S)-5-amino-2-[bis(4-hydroxybenzoyl)amino]pentanoic acid |
| SMILES | NCCC[C@@H](C(=O)O)N(C(=O)c1ccc(O)cc1)C(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C19H20N2O6/c20-11-1-2-16(19(26)27)21(17(24)12-3-7-14(22)8-4-12)18(25)13-5-9-15(23)10-6-13/h3-10,16,22-23H,1-2,11,20H2,(H,26,27)/t16-/m0/s1 |
| InChIKey | PJGHITQCMBYEEX-INIZCTEOSA-N |
| XLogP | 1.57 |
| TPSA | 141.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|