C12H21N3O4 — CID 161228325
azane;(2S)-2,5-diaminopentanoic acid;4-hydroxybenzaldehyde (PubChem CID 161228325) has the molecular formula C12H21N3O4 and a molecular weight of 271.32 g/mol. Its IUPAC name is azane;(2S)-2,5-diaminopentanoic acid;4-hydroxybenzaldehyde.
| Compound Name | azane;(2S)-2,5-diaminopentanoic acid;4-hydroxybenzaldehyde |
|---|---|
| PubChem CID | 161228325 |
| Molecular Formula | C12H21N3O4 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | azane;(2S)-2,5-diaminopentanoic acid;4-hydroxybenzaldehyde |
| SMILES | N.NCCC[C@H](N)C(=O)O.O=Cc1ccc(O)cc1 |
| InChI | InChI=1S/C7H6O2.C5H12N2O2.H3N/c8-5-6-1-3-7(9)4-2-6;6-3-1-2-4(7)5(8)9;/h1-5,9H;4H,1-3,6-7H2,(H,8,9);1H3/t;4-;/m.0./s1 |
| InChIKey | UYKMLLKWABHIMF-INZIHYEWSA-N |
| XLogP | 0.50 |
| TPSA | 161.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|