C24H36N3O3+ — CID 173276644
cyclohexanamine;(2S)-2,5-diaminopentanoic acid;hydron;4-phenylbenzaldehyde (PubChem CID 173276644) has the molecular formula C24H36N3O3+ and a molecular weight of 414.57 g/mol. Its IUPAC name is cyclohexanamine;(2S)-2,5-diaminopentanoic acid;hydron;4-phenylbenzaldehyde.
| Compound Name | cyclohexanamine;(2S)-2,5-diaminopentanoic acid;hydron;4-phenylbenzaldehyde |
|---|---|
| PubChem CID | 173276644 |
| Molecular Formula | C24H36N3O3+ |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.28 |
| IUPAC Name | cyclohexanamine;(2S)-2,5-diaminopentanoic acid;hydron;4-phenylbenzaldehyde |
| SMILES | NC1CCCCC1.NCCC[C@H](N)C(=O)O.O=Cc1ccc(-c2ccccc2)cc1.[H+] |
| InChI | InChI=1S/C13H10O.C6H13N.C5H12N2O2/c14-10-11-6-8-13(9-7-11)12-4-2-1-3-5-12;7-6-4-2-1-3-5-6;6-3-1-2-4(7)5(8)9/h1-10H;6H,1-5,7H2;4H,1-3,6-7H2,(H,8,9)/p+1/t;;4-/m..0/s1 |
| InChIKey | VUHVDNSCTXZNPS-MCIOAOFGSA-O |
| XLogP | 3.69 |
| TPSA | 132.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|