C19H32Cl2N3O3+ — CID 173276689
cyclohexanamine;(2S)-2,6-diaminohexanoic acid;2,4-dichlorobenzaldehyde;hydron (PubChem CID 173276689) has the molecular formula C19H32Cl2N3O3+ and a molecular weight of 421.39 g/mol. Its IUPAC name is cyclohexanamine;(2S)-2,6-diaminohexanoic acid;2,4-dichlorobenzaldehyde;hydron.
| Compound Name | cyclohexanamine;(2S)-2,6-diaminohexanoic acid;2,4-dichlorobenzaldehyde;hydron |
|---|---|
| PubChem CID | 173276689 |
| Molecular Formula | C19H32Cl2N3O3+ |
| Molecular Weight | 421.39 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | cyclohexanamine;(2S)-2,6-diaminohexanoic acid;2,4-dichlorobenzaldehyde;hydron |
| SMILES | NC1CCCCC1.NCCCC[C@H](N)C(=O)O.O=Cc1ccc(Cl)cc1Cl.[H+] |
| InChI | InChI=1S/C7H4Cl2O.C6H14N2O2.C6H13N/c8-6-2-1-5(4-10)7(9)3-6;7-4-2-1-3-5(8)6(9)10;7-6-4-2-1-3-5-6/h1-4H;5H,1-4,7-8H2,(H,9,10);6H,1-5,7H2/p+1/t;5-;/m.0./s1 |
| InChIKey | KSJDVONQIMIEQS-NXAOXGSFSA-O |
| XLogP | 3.72 |
| TPSA | 132.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.39 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|