C17H28Cl2N3O3+ — CID 173276988
cyclohexanamine;(2S)-2,4-diaminobutanoic acid;2,4-dichlorobenzaldehyde;hydron (PubChem CID 173276988) has the molecular formula C17H28Cl2N3O3+ and a molecular weight of 393.34 g/mol. Its IUPAC name is cyclohexanamine;(2S)-2,4-diaminobutanoic acid;2,4-dichlorobenzaldehyde;hydron.
| Compound Name | cyclohexanamine;(2S)-2,4-diaminobutanoic acid;2,4-dichlorobenzaldehyde;hydron |
|---|---|
| PubChem CID | 173276988 |
| Molecular Formula | C17H28Cl2N3O3+ |
| Molecular Weight | 393.34 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | cyclohexanamine;(2S)-2,4-diaminobutanoic acid;2,4-dichlorobenzaldehyde;hydron |
| SMILES | NC1CCCCC1.NCC[C@H](N)C(=O)O.O=Cc1ccc(Cl)cc1Cl.[H+] |
| InChI | InChI=1S/C7H4Cl2O.C6H13N.C4H10N2O2/c8-6-2-1-5(4-10)7(9)3-6;7-6-4-2-1-3-5-6;5-2-1-3(6)4(7)8/h1-4H;6H,1-5,7H2;3H,1-2,5-6H2,(H,7,8)/p+1/t;;3-/m..0/s1 |
| InChIKey | YTPSPGUKDYUIMY-VYFHOAEYSA-O |
| XLogP | 2.94 |
| TPSA | 132.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.34 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|