C21H30Cl2N3O4+ — CID 173276678
(2R)-2,6-diaminohexanoic acid;2,4-dichlorobenzaldehyde;hydron;(2-methoxyphenyl)methanamine (PubChem CID 173276678) has the molecular formula C21H30Cl2N3O4+ and a molecular weight of 459.39 g/mol. Its IUPAC name is (2R)-2,6-diaminohexanoic acid;2,4-dichlorobenzaldehyde;hydron;(2-methoxyphenyl)methanamine.
| Compound Name | (2R)-2,6-diaminohexanoic acid;2,4-dichlorobenzaldehyde;hydron;(2-methoxyphenyl)methanamine |
|---|---|
| PubChem CID | 173276678 |
| Molecular Formula | C21H30Cl2N3O4+ |
| Molecular Weight | 459.39 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | (2R)-2,6-diaminohexanoic acid;2,4-dichlorobenzaldehyde;hydron;(2-methoxyphenyl)methanamine |
| SMILES | COc1ccccc1CN.NCCCC[C@@H](N)C(=O)O.O=Cc1ccc(Cl)cc1Cl.[H+] |
| InChI | InChI=1S/C8H11NO.C7H4Cl2O.C6H14N2O2/c1-10-8-5-3-2-4-7(8)6-9;8-6-2-1-5(4-10)7(9)3-6;7-4-2-1-3-5(8)6(9)10/h2-5H,6,9H2,1H3;1-4H;5H,1-4,7-8H2,(H,9,10)/p+1/t;;5-/m..1/s1 |
| InChIKey | YWPZDCDVLOYTBI-XHYJPTDKSA-O |
| XLogP | 3.60 |
| TPSA | 141.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.39 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|