C19H32N2O4 — CID 70561676
(2S)-2,6-diaminohexanoic acid;[2-(2-methylpropyl)phenyl] propanoate (PubChem CID 70561676) has the molecular formula C19H32N2O4 and a molecular weight of 352.48 g/mol. Its IUPAC name is (2S)-2,6-diaminohexanoic acid;[2-(2-methylpropyl)phenyl] propanoate.
| Compound Name | (2S)-2,6-diaminohexanoic acid;[2-(2-methylpropyl)phenyl] propanoate |
|---|---|
| PubChem CID | 70561676 |
| Molecular Formula | C19H32N2O4 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | (2S)-2,6-diaminohexanoic acid;[2-(2-methylpropyl)phenyl] propanoate |
| SMILES | CCC(=O)Oc1ccccc1CC(C)C.NCCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C13H18O2.C6H14N2O2/c1-4-13(14)15-12-8-6-5-7-11(12)9-10(2)3;7-4-2-1-3-5(8)6(9)10/h5-8,10H,4,9H2,1-3H3;5H,1-4,7-8H2,(H,9,10)/t;5-/m.0/s1 |
| InChIKey | IZZXWKWPQYTJNB-ZSCHJXSPSA-N |
| XLogP | 2.73 |
| TPSA | 115.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|