About [2-(2-methylpropyl)phenyl] 2-fluoroacetate
[2-(2-methylpropyl)phenyl] 2-fluoroacetate (PubChem CID 150064883) has the molecular formula C12H15FO2
and a molecular weight of 210.25 g/mol. Its IUPAC name is [2-(2-methylpropyl)phenyl] 2-fluoroacetate.
Molecular Properties
| Compound Name | [2-(2-methylpropyl)phenyl] 2-fluoroacetate |
| PubChem CID | 150064883 |
| Molecular Formula | C12H15FO2 |
| Molecular Weight | 210.25 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | [2-(2-methylpropyl)phenyl] 2-fluoroacetate |
| SMILES | CC(C)Cc1ccccc1OC(=O)CF |
| InChI | InChI=1S/C12H15FO2/c1-9(2)7-10-5-3-4-6-11(10)15-12(14)8-13/h3-6,9H,7-8H2,1-2H3 |
| InChIKey | DOBLYJHJBFDSMW-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.25 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-(2-methylpropyl)phenyl] 2-fluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-methylpropyl)phenyl] 2-fluoroacetate?
The IUPAC name of [2-(2-methylpropyl)phenyl] 2-fluoroacetate (CID 150064883) is [2-(2-methylpropyl)phenyl] 2-fluoroacetate.
What is the SMILES notation for [2-(2-methylpropyl)phenyl] 2-fluoroacetate?
The canonical SMILES for [2-(2-methylpropyl)phenyl] 2-fluoroacetate is CC(C)Cc1ccccc1OC(=O)CF.
What is the InChIKey of [2-(2-methylpropyl)phenyl] 2-fluoroacetate?
The InChIKey is DOBLYJHJBFDSMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15FO2/c1-9(2)7-10-5-3-4-6-11(10)15-12(14)8-13/h3-6,9H,7-8H2,1-2H3.
What are the key properties of [2-(2-methylpropyl)phenyl] 2-fluoroacetate?
[2-(2-methylpropyl)phenyl] 2-fluoroacetate has a molecular weight of 210.25 g/mol, XLogP of 2.76, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-methylpropyl)phenyl] 2-fluoroacetate is sourced from PubChem (CID 150064883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).