C15H25N3O — CID 175054462
2,6-diamino-1-[2-(2-aminopropyl)phenyl]hexan-1-one (PubChem CID 175054462) has the molecular formula C15H25N3O and a molecular weight of 263.38 g/mol. Its IUPAC name is 2,6-diamino-1-[2-(2-aminopropyl)phenyl]hexan-1-one.
| Compound Name | 2,6-diamino-1-[2-(2-aminopropyl)phenyl]hexan-1-one |
|---|---|
| PubChem CID | 175054462 |
| Molecular Formula | C15H25N3O |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | 2,6-diamino-1-[2-(2-aminopropyl)phenyl]hexan-1-one |
| SMILES | CC(N)Cc1ccccc1C(=O)C(N)CCCCN |
| InChI | InChI=1S/C15H25N3O/c1-11(17)10-12-6-2-3-7-13(12)15(19)14(18)8-4-5-9-16/h2-3,6-7,11,14H,4-5,8-10,16-18H2,1H3 |
| InChIKey | UAXJNDVOPGKZCF-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 95.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|